C25H36ClNO2Si — CID 159768408
1-[4-[tert-butyl(diphenyl)silyl]oxybutyl-(chloromethyl)amino]butan-2-one (PubChem CID 159768408) has the molecular formula C25H36ClNO2Si and a molecular weight of 446.11 g/mol. Its IUPAC name is 1-[4-[tert-butyl(diphenyl)silyl]oxybutyl-(chloromethyl)amino]butan-2-one.
| Compound Name | 1-[4-[tert-butyl(diphenyl)silyl]oxybutyl-(chloromethyl)amino]butan-2-one |
|---|---|
| PubChem CID | 159768408 |
| Molecular Formula | C25H36ClNO2Si |
| Molecular Weight | 446.11 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 1-[4-[tert-butyl(diphenyl)silyl]oxybutyl-(chloromethyl)amino]butan-2-one |
| SMILES | CCC(=O)CN(CCl)CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H36ClNO2Si/c1-5-22(28)20-27(21-26)18-12-13-19-29-30(25(2,3)4,23-14-8-6-9-15-23)24-16-10-7-11-17-24/h6-11,14-17H,5,12-13,18-21H2,1-4H3 |
| InChIKey | PJSVXYOXFXRUSD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.11 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|