C40H47NO4Si — CID 157143276
9H-fluoren-9-ylmethyl 2-[4-[tert-butyl(diphenyl)silyl]oxybutyl-(2-oxobutyl)amino]acetate (PubChem CID 157143276) has the molecular formula C40H47NO4Si and a molecular weight of 633.91 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 2-[4-[tert-butyl(diphenyl)silyl]oxybutyl-(2-oxobutyl)amino]acetate.
| Compound Name | 9H-fluoren-9-ylmethyl 2-[4-[tert-butyl(diphenyl)silyl]oxybutyl-(2-oxobutyl)amino]acetate |
|---|---|
| PubChem CID | 157143276 |
| Molecular Formula | C40H47NO4Si |
| Molecular Weight | 633.91 g/mol |
| Exact Mass | 633.33 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 2-[4-[tert-butyl(diphenyl)silyl]oxybutyl-(2-oxobutyl)amino]acetate |
| SMILES | CCC(=O)CN(CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C40H47NO4Si/c1-5-31(42)28-41(29-39(43)44-30-38-36-24-14-12-22-34(36)35-23-13-15-25-37(35)38)26-16-17-27-45-46(40(2,3)4,32-18-8-6-9-19-32)33-20-10-7-11-21-33/h6-15,18-25,38H,5,16-17,26-30H2,1-4H3 |
| InChIKey | KXGULIBVNXMJQP-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.91 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|