C37H42N2O5Si — CID 58841936
9H-fluoren-9-ylmethyl N-[1-[3-[tert-butyl(diphenyl)silyl]oxypropylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 58841936) has the molecular formula C37H42N2O5Si and a molecular weight of 622.84 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[1-[3-[tert-butyl(diphenyl)silyl]oxypropylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[1-[3-[tert-butyl(diphenyl)silyl]oxypropylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 58841936 |
| Molecular Formula | C37H42N2O5Si |
| Molecular Weight | 622.84 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[1-[3-[tert-butyl(diphenyl)silyl]oxypropylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)[Si](OCCCNC(=O)C(CO)NC(=O)OCC1c2ccccc2-c2ccccc21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H42N2O5Si/c1-37(2,3)45(27-15-6-4-7-16-27,28-17-8-5-9-18-28)44-24-14-23-38-35(41)34(25-40)39-36(42)43-26-33-31-21-12-10-19-29(31)30-20-11-13-22-32(30)33/h4-13,15-22,33-34,40H,14,23-26H2,1-3H3,(H,38,41)(H,39,42) |
| InChIKey | XUUFKOUJSZCSRD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.84 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|