C21H22N2O6 — CID 167170098
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2-hydroxyethylamino)-4-oxobutanoic acid (PubChem CID 167170098) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2-hydroxyethylamino)-4-oxobutanoic acid.
| Compound Name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2-hydroxyethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 167170098 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2-hydroxyethylamino)-4-oxobutanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCCO |
| InChI | InChI=1S/C21H22N2O6/c24-10-9-22-20(27)18(11-19(25)26)23-21(28)29-12-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,17-18,24H,9-12H2,(H,22,27)(H,23,28)(H,25,26)/t18-/m0/s1 |
| InChIKey | HHYWAIUKQJTMDV-SFHVURJKSA-N |
| XLogP | 1.48 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |