C33H45N5O8 — CID 71050746
9H-fluoren-9-ylmethyl N-[(2S)-1,4-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 71050746) has the molecular formula C33H45N5O8 and a molecular weight of 639.75 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1,4-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1,4-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 71050746 |
| Molecular Formula | C33H45N5O8 |
| Molecular Weight | 639.75 g/mol |
| Exact Mass | 639.33 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1,4-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H45N5O8/c1-32(2,3)45-29(41)36-17-15-34-27(39)19-26(28(40)35-16-18-37-30(42)46-33(4,5)6)38-31(43)44-20-25-23-13-9-7-11-21(23)22-12-8-10-14-24(22)25/h7-14,25-26H,15-20H2,1-6H3,(H,34,39)(H,35,40)(H,36,41)(H,37,42)(H,38,43)/t26-/m0/s1 |
| InChIKey | BZPGSRPHJKZUSN-SANMLTNESA-N |
| XLogP | 3.57 |
| TPSA | 173.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.75 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|