C28H35N5O7 — CID 170946250
tert-butyl N-[2-[[2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate (PubChem CID 170946250) has the molecular formula C28H35N5O7 and a molecular weight of 553.62 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 170946250 |
| Molecular Formula | C28H35N5O7 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | tert-butyl N-[2-[[2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)CNC(=O)CNC(=O)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H35N5O7/c1-28(2,3)40-27(38)30-13-12-29-23(34)14-31-24(35)15-32-25(36)16-33-26(37)39-17-22-20-10-6-4-8-18(20)19-9-5-7-11-21(19)22/h4-11,22H,12-17H2,1-3H3,(H,29,34)(H,30,38)(H,31,35)(H,32,36)(H,33,37) |
| InChIKey | PTAAISIFGDXDSZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 163.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|