C22H24N2O8S — CID 164586503
(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(2-sulfoethylamino)pentanoic acid (PubChem CID 164586503) has the molecular formula C22H24N2O8S and a molecular weight of 476.51 g/mol. Its IUPAC name is (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(2-sulfoethylamino)pentanoic acid.
| Compound Name | (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(2-sulfoethylamino)pentanoic acid |
|---|---|
| PubChem CID | 164586503 |
| Molecular Formula | C22H24N2O8S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(2-sulfoethylamino)pentanoic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C22H24N2O8S/c25-20(26)10-9-19(21(27)23-11-12-33(29,30)31)24-22(28)32-13-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-8,18-19H,9-13H2,(H,23,27)(H,24,28)(H,25,26)(H,29,30,31)/t19-/m0/s1 |
| InChIKey | CKRDDRPZEBIXHI-IBGZPJMESA-N |
| XLogP | 1.76 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|