C31H39N3O8S — CID 88558125
2-[8-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfanylpropanoyl]amino]octanoylamino]pentanedioic acid (PubChem CID 88558125) has the molecular formula C31H39N3O8S and a molecular weight of 613.73 g/mol. Its IUPAC name is 2-[8-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfanylpropanoyl]amino]octanoylamino]pentanedioic acid.
| Compound Name | 2-[8-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfanylpropanoyl]amino]octanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 88558125 |
| Molecular Formula | C31H39N3O8S |
| Molecular Weight | 613.73 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | 2-[8-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfanylpropanoyl]amino]octanoylamino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)CCCCCCCNC(=O)C(CS)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C31H39N3O8S/c35-27(33-25(30(39)40)15-16-28(36)37)14-4-2-1-3-9-17-32-29(38)26(19-43)34-31(41)42-18-24-22-12-7-5-10-20(22)21-11-6-8-13-23(21)24/h5-8,10-13,24-26,43H,1-4,9,14-19H2,(H,32,38)(H,33,35)(H,34,41)(H,36,37)(H,39,40) |
| InChIKey | QMSNWHBXTPXIGP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 171.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.73 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|