C33H38N2O5 — CID 71530257
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(6-phenylhexanoylamino)hexanoic acid (PubChem CID 71530257) has the molecular formula C33H38N2O5 and a molecular weight of 542.68 g/mol. Its IUPAC name is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(6-phenylhexanoylamino)hexanoic acid.
| Compound Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(6-phenylhexanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 71530257 |
| Molecular Formula | C33H38N2O5 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(6-phenylhexanoylamino)hexanoic acid |
| SMILES | O=C(CCCCCc1ccccc1)NCCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C33H38N2O5/c36-31(21-6-2-5-15-24-13-3-1-4-14-24)34-22-12-11-20-30(32(37)38)35-33(39)40-23-29-27-18-9-7-16-25(27)26-17-8-10-19-28(26)29/h1,3-4,7-10,13-14,16-19,29-30H,2,5-6,11-12,15,20-23H2,(H,34,36)(H,35,39)(H,37,38)/t30-/m0/s1 |
| InChIKey | OUDIGNGERLRJMT-PMERELPUSA-N |
| XLogP | 6.07 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|