C36H39NO5Si — CID 73054939
(2R,3S)-4-[tert-butyl(diphenyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid (PubChem CID 73054939) has the molecular formula C36H39NO5Si and a molecular weight of 593.80 g/mol. Its IUPAC name is (2R,3S)-4-[tert-butyl(diphenyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid.
| Compound Name | (2R,3S)-4-[tert-butyl(diphenyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 73054939 |
| Molecular Formula | C36H39NO5Si |
| Molecular Weight | 593.80 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | (2R,3S)-4-[tert-butyl(diphenyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid |
| SMILES | C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C36H39NO5Si/c1-25(23-42-43(36(2,3)4,26-15-7-5-8-16-26)27-17-9-6-10-18-27)33(34(38)39)37-35(40)41-24-32-30-21-13-11-19-28(30)29-20-12-14-22-31(29)32/h5-22,25,32-33H,23-24H2,1-4H3,(H,37,40)(H,38,39)/t25-,33-/m1/s1 |
| InChIKey | OFOLLRUHBISQQF-INJOXJOKSA-N |
| XLogP | 6.19 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.80 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|