C25H32N2O6Si — CID 59669456
(2S)-4-amino-3-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid (PubChem CID 59669456) has the molecular formula C25H32N2O6Si and a molecular weight of 484.63 g/mol. Its IUPAC name is (2S)-4-amino-3-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-3-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59669456 |
| Molecular Formula | C25H32N2O6Si |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | (2S)-4-amino-3-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(C(N)=O)[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C25H32N2O6Si/c1-25(2,3)34(4,5)33-21(22(26)28)20(23(29)30)27-24(31)32-14-19-17-12-8-6-10-15(17)16-11-7-9-13-18(16)19/h6-13,19-21H,14H2,1-5H3,(H2,26,28)(H,27,31)(H,29,30)/t20-,21?/m0/s1 |
| InChIKey | DLWLSWGXAFZJHR-BGERDNNASA-N |
| XLogP | 3.85 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|