C28H35NO7Si — CID 102313420
(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid (PubChem CID 102313420) has the molecular formula C28H35NO7Si and a molecular weight of 525.67 g/mol. Its IUPAC name is (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid.
| Compound Name | (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid |
|---|---|
| PubChem CID | 102313420 |
| Molecular Formula | C28H35NO7Si |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid |
| SMILES | C=CCOC(=O)[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C28H35NO7Si/c1-7-16-34-26(32)23(24(25(30)31)36-37(5,6)28(2,3)4)29-27(33)35-17-22-20-14-10-8-12-18(20)19-13-9-11-15-21(19)22/h7-15,22-24H,1,16-17H2,2-6H3,(H,29,33)(H,30,31)/t23-,24-/m1/s1 |
| InChIKey | ZGCBCWQNKOSZEC-DNQXCXABSA-N |
| XLogP | 5.10 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|