C31H40N2O7Si — CID 155788475
(2,5-dioxopyrrolidin-1-yl) (3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoate (PubChem CID 155788475) has the molecular formula C31H40N2O7Si and a molecular weight of 580.75 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoate |
|---|---|
| PubChem CID | 155788475 |
| Molecular Formula | C31H40N2O7Si |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoate |
| SMILES | C[C@H](C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)ON1C(=O)CCC1=O)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H40N2O7Si/c1-19(20(2)40-41(6,7)31(3,4)5)28(29(36)39-33-26(34)16-17-27(33)35)32-30(37)38-18-25-23-14-10-8-12-21(23)22-13-9-11-15-24(22)25/h8-15,19-20,25,28H,16-18H2,1-7H3,(H,32,37)/t19-,20+,28?/m0/s1 |
| InChIKey | PUOCCVMJRBKOMK-VWGXNCFZSA-N |
| XLogP | 5.55 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|