C40H63NO6Si2 — CID 101237238
(E,2S,4S,7S,8S)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-8-(9H-fluoren-9-ylmethoxycarbonylamino)-2,10-dimethylundec-5-enoic acid (PubChem CID 101237238) has the molecular formula C40H63NO6Si2 and a molecular weight of 710.12 g/mol. Its IUPAC name is (E,2S,4S,7S,8S)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-8-(9H-fluoren-9-ylmethoxycarbonylamino)-2,10-dimethylundec-5-enoic acid.
| Compound Name | (E,2S,4S,7S,8S)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-8-(9H-fluoren-9-ylmethoxycarbonylamino)-2,10-dimethylundec-5-enoic acid |
|---|---|
| PubChem CID | 101237238 |
| Molecular Formula | C40H63NO6Si2 |
| Molecular Weight | 710.12 g/mol |
| Exact Mass | 709.42 |
| IUPAC Name | (E,2S,4S,7S,8S)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-8-(9H-fluoren-9-ylmethoxycarbonylamino)-2,10-dimethylundec-5-enoic acid |
| SMILES | CC(C)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)[C@H](/C=C/[C@H](C[C@H](C)C(=O)O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H63NO6Si2/c1-27(2)24-35(41-38(44)45-26-34-32-20-16-14-18-30(32)31-19-15-17-21-33(31)34)36(47-49(12,13)40(7,8)9)23-22-29(25-28(3)37(42)43)46-48(10,11)39(4,5)6/h14-23,27-29,34-36H,24-26H2,1-13H3,(H,41,44)(H,42,43)/b23-22+/t28-,29+,35-,36-/m0/s1 |
| InChIKey | FKNNZZUUZQUDFH-OXQHMXOGSA-N |
| XLogP | 10.39 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.12 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|