C24H25NO6 — CID 59669497
(3S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-5-oxo-5-prop-2-enoxypentanoic acid (PubChem CID 59669497) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is (3S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-5-oxo-5-prop-2-enoxypentanoic acid.
| Compound Name | (3S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-5-oxo-5-prop-2-enoxypentanoic acid |
|---|---|
| PubChem CID | 59669497 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (3S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-5-oxo-5-prop-2-enoxypentanoic acid |
| SMILES | C=CCOC(=O)C(NC(=O)OCC1c2ccccc2-c2ccccc21)[C@@H](C)CC(=O)O |
| InChI | InChI=1S/C24H25NO6/c1-3-12-30-23(28)22(15(2)13-21(26)27)25-24(29)31-14-20-18-10-6-4-8-16(18)17-9-5-7-11-19(17)20/h3-11,15,20,22H,1,12-14H2,2H3,(H,25,29)(H,26,27)/t15-,22?/m0/s1 |
| InChIKey | VPOKGLFGBQEZHG-UEDXYCIISA-N |
| XLogP | 3.73 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|