C38H65NO3Si — CID 169273518
10-[2-[tert-butyl(diphenyl)silyl]oxyethyl-(10-hydroxydecyl)amino]decan-1-ol (PubChem CID 169273518) has the molecular formula C38H65NO3Si and a molecular weight of 612.03 g/mol. Its IUPAC name is 10-[2-[tert-butyl(diphenyl)silyl]oxyethyl-(10-hydroxydecyl)amino]decan-1-ol.
| Compound Name | 10-[2-[tert-butyl(diphenyl)silyl]oxyethyl-(10-hydroxydecyl)amino]decan-1-ol |
|---|---|
| PubChem CID | 169273518 |
| Molecular Formula | C38H65NO3Si |
| Molecular Weight | 612.03 g/mol |
| Exact Mass | 611.47 |
| IUPAC Name | 10-[2-[tert-butyl(diphenyl)silyl]oxyethyl-(10-hydroxydecyl)amino]decan-1-ol |
| SMILES | CC(C)(C)[Si](OCCN(CCCCCCCCCCO)CCCCCCCCCCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H65NO3Si/c1-38(2,3)43(36-26-18-16-19-27-36,37-28-20-17-21-29-37)42-35-32-39(30-22-12-8-4-6-10-14-24-33-40)31-23-13-9-5-7-11-15-25-34-41/h16-21,26-29,40-41H,4-15,22-25,30-35H2,1-3H3 |
| InChIKey | KGSQBJKFKLQSRS-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.03 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|