C32H43NO3Si — CID 10768218
N-tert-butyl-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(3-hydroxypropyl)benzamide (PubChem CID 10768218) has the molecular formula C32H43NO3Si and a molecular weight of 517.79 g/mol. Its IUPAC name is N-tert-butyl-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(3-hydroxypropyl)benzamide.
| Compound Name | N-tert-butyl-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(3-hydroxypropyl)benzamide |
|---|---|
| PubChem CID | 10768218 |
| Molecular Formula | C32H43NO3Si |
| Molecular Weight | 517.79 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | N-tert-butyl-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(3-hydroxypropyl)benzamide |
| SMILES | CC(C)(C)N(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)c1ccccc1CCCO |
| InChI | InChI=1S/C32H43NO3Si/c1-31(2,3)33(30(35)29-22-14-13-16-26(29)17-15-24-34)23-25-36-37(32(4,5)6,27-18-9-7-10-19-27)28-20-11-8-12-21-28/h7-14,16,18-22,34H,15,17,23-25H2,1-6H3 |
| InChIKey | ISGDNVSJXZAWTM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.79 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|