C24H36O3Si — CID 154423315
3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]hexane-1,6-diol (PubChem CID 154423315) has the molecular formula C24H36O3Si and a molecular weight of 400.64 g/mol. Its IUPAC name is 3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]hexane-1,6-diol.
| Compound Name | 3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]hexane-1,6-diol |
|---|---|
| PubChem CID | 154423315 |
| Molecular Formula | C24H36O3Si |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]hexane-1,6-diol |
| SMILES | CC(C)(C)[Si](OCCC(CCO)CCCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H36O3Si/c1-24(2,3)28(22-12-6-4-7-13-22,23-14-8-5-9-15-23)27-20-17-21(16-19-26)11-10-18-25/h4-9,12-15,21,25-26H,10-11,16-20H2,1-3H3 |
| InChIKey | IXNBVUMXDNUIOC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|