C26H40O2Si — CID 73077971
8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloctan-1-ol (PubChem CID 73077971) has the molecular formula C26H40O2Si and a molecular weight of 412.69 g/mol. Its IUPAC name is 8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloctan-1-ol.
| Compound Name | 8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloctan-1-ol |
|---|---|
| PubChem CID | 73077971 |
| Molecular Formula | C26H40O2Si |
| Molecular Weight | 412.69 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloctan-1-ol |
| SMILES | CC(CCO)CCCC(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H40O2Si/c1-22(19-20-27)13-12-14-23(2)21-28-29(26(3,4)5,24-15-8-6-9-16-24)25-17-10-7-11-18-25/h6-11,15-18,22-23,27H,12-14,19-21H2,1-5H3 |
| InChIKey | BLBODZDPXOXREH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|