C24H36O4Si — CID 11742663
(3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)-3-methylpentan-1-ol (PubChem CID 11742663) has the molecular formula C24H36O4Si and a molecular weight of 416.63 g/mol. Its IUPAC name is (3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)-3-methylpentan-1-ol.
| Compound Name | (3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 11742663 |
| Molecular Formula | C24H36O4Si |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)-3-methylpentan-1-ol |
| SMILES | COCO[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)CCO |
| InChI | InChI=1S/C24H36O4Si/c1-20(16-17-25)23(27-19-26-5)18-28-29(24(2,3)4,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-15,20,23,25H,16-19H2,1-5H3/t20-,23+/m0/s1 |
| InChIKey | SOZPRBCNABQZBH-NZQKXSOJSA-N |
| XLogP | 3.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|