C27H40O5Si — CID 11134524
ethyl (2R,3R,4S)-5-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)-2,4-dimethylpentanoate (PubChem CID 11134524) has the molecular formula C27H40O5Si and a molecular weight of 472.70 g/mol. Its IUPAC name is ethyl (2R,3R,4S)-5-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)-2,4-dimethylpentanoate.
| Compound Name | ethyl (2R,3R,4S)-5-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 11134524 |
| Molecular Formula | C27H40O5Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | ethyl (2R,3R,4S)-5-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)-2,4-dimethylpentanoate |
| SMILES | CCOC(=O)[C@H](C)[C@H](OCOC)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40O5Si/c1-8-30-26(28)22(3)25(31-20-29-7)21(2)19-32-33(27(4,5)6,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,21-22,25H,8,19-20H2,1-7H3/t21-,22+,25+/m0/s1 |
| InChIKey | IHJPGCHDMUQLGT-SGIRGMQISA-N |
| XLogP | 4.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|