C22H30O3Si — CID 53492893
methyl (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]butanoate (PubChem CID 53492893) has the molecular formula C22H30O3Si and a molecular weight of 370.57 g/mol. Its IUPAC name is methyl (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]butanoate.
| Compound Name | methyl (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]butanoate |
|---|---|
| PubChem CID | 53492893 |
| Molecular Formula | C22H30O3Si |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | methyl (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]butanoate |
| SMILES | CC[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C22H30O3Si/c1-6-18(21(23)24-5)17-25-26(22(2,3)4,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18H,6,17H2,1-5H3/t18-/m1/s1 |
| InChIKey | QWASXBBLLWKLAS-GOSISDBHSA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|