C22H28O4Si — CID 22100308
5-[tert-butyl(diphenyl)silyl]oxy-4-methyl-3-oxopentanoic acid (PubChem CID 22100308) has the molecular formula C22H28O4Si and a molecular weight of 384.55 g/mol. Its IUPAC name is 5-[tert-butyl(diphenyl)silyl]oxy-4-methyl-3-oxopentanoic acid.
| Compound Name | 5-[tert-butyl(diphenyl)silyl]oxy-4-methyl-3-oxopentanoic acid |
|---|---|
| PubChem CID | 22100308 |
| Molecular Formula | C22H28O4Si |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 5-[tert-butyl(diphenyl)silyl]oxy-4-methyl-3-oxopentanoic acid |
| SMILES | CC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)CC(=O)O |
| InChI | InChI=1S/C22H28O4Si/c1-17(20(23)15-21(24)25)16-26-27(22(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,17H,15-16H2,1-4H3,(H,24,25) |
| InChIKey | MTHRXWRHLXBAMB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|