C20H29NO2Si — CID 21062594
[1-[tert-butyl(diphenyl)silyl]oxypropan-2-ylamino]methanol (PubChem CID 21062594) has the molecular formula C20H29NO2Si and a molecular weight of 343.54 g/mol. Its IUPAC name is [1-[tert-butyl(diphenyl)silyl]oxypropan-2-ylamino]methanol.
| Compound Name | [1-[tert-butyl(diphenyl)silyl]oxypropan-2-ylamino]methanol |
|---|---|
| PubChem CID | 21062594 |
| Molecular Formula | C20H29NO2Si |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | [1-[tert-butyl(diphenyl)silyl]oxypropan-2-ylamino]methanol |
| SMILES | CC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NCO |
| InChI | InChI=1S/C20H29NO2Si/c1-17(21-16-22)15-23-24(20(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,17,21-22H,15-16H2,1-4H3 |
| InChIKey | GSGCOLSWMLWCTR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|