C38H50O4Si2 — CID 10746539
(2R,5R)-1,6-bis[[tert-butyl(diphenyl)silyl]oxy]hexane-2,5-diol (PubChem CID 10746539) has the molecular formula C38H50O4Si2 and a molecular weight of 626.99 g/mol. Its IUPAC name is (2R,5R)-1,6-bis[[tert-butyl(diphenyl)silyl]oxy]hexane-2,5-diol.
| Compound Name | (2R,5R)-1,6-bis[[tert-butyl(diphenyl)silyl]oxy]hexane-2,5-diol |
|---|---|
| PubChem CID | 10746539 |
| Molecular Formula | C38H50O4Si2 |
| Molecular Weight | 626.99 g/mol |
| Exact Mass | 626.32 |
| IUPAC Name | (2R,5R)-1,6-bis[[tert-butyl(diphenyl)silyl]oxy]hexane-2,5-diol |
| SMILES | CC(C)(C)[Si](OC[C@H](O)CC[C@@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H50O4Si2/c1-37(2,3)43(33-19-11-7-12-20-33,34-21-13-8-14-22-34)41-29-31(39)27-28-32(40)30-42-44(38(4,5)6,35-23-15-9-16-24-35)36-25-17-10-18-26-36/h7-26,31-32,39-40H,27-30H2,1-6H3/t31-,32-/m1/s1 |
| InChIKey | RQGOAYIUBUGWKR-ROJLCIKYSA-N |
| XLogP | 5.64 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.99 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|