C28H36O3Si — CID 11762130
1-[tert-butyl(diphenyl)silyl]oxy-5-phenylmethoxypentan-2-ol (PubChem CID 11762130) has the molecular formula C28H36O3Si and a molecular weight of 448.68 g/mol. Its IUPAC name is 1-[tert-butyl(diphenyl)silyl]oxy-5-phenylmethoxypentan-2-ol.
| Compound Name | 1-[tert-butyl(diphenyl)silyl]oxy-5-phenylmethoxypentan-2-ol |
|---|---|
| PubChem CID | 11762130 |
| Molecular Formula | C28H36O3Si |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1-[tert-butyl(diphenyl)silyl]oxy-5-phenylmethoxypentan-2-ol |
| SMILES | CC(C)(C)[Si](OCC(O)CCCOCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H36O3Si/c1-28(2,3)32(26-17-9-5-10-18-26,27-19-11-6-12-20-27)31-23-25(29)16-13-21-30-22-24-14-7-4-8-15-24/h4-12,14-15,17-20,25,29H,13,16,21-23H2,1-3H3 |
| InChIKey | UOBBKVFEPASYFT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|