C29H34O2Si — CID 134872566
tert-butyl-diphenyl-[(3R)-6-phenylmethoxyhex-1-yn-3-yl]oxysilane (PubChem CID 134872566) has the molecular formula C29H34O2Si and a molecular weight of 442.68 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(3R)-6-phenylmethoxyhex-1-yn-3-yl]oxysilane.
| Compound Name | tert-butyl-diphenyl-[(3R)-6-phenylmethoxyhex-1-yn-3-yl]oxysilane |
|---|---|
| PubChem CID | 134872566 |
| Molecular Formula | C29H34O2Si |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | tert-butyl-diphenyl-[(3R)-6-phenylmethoxyhex-1-yn-3-yl]oxysilane |
| SMILES | C#C[C@@H](CCCOCc1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H34O2Si/c1-5-26(18-15-23-30-24-25-16-9-6-10-17-25)31-32(29(2,3)4,27-19-11-7-12-20-27)28-21-13-8-14-22-28/h1,6-14,16-17,19-22,26H,15,18,23-24H2,2-4H3/t26-/m0/s1 |
| InChIKey | NAFMYXDSFGYQGS-SANMLTNESA-N |
| XLogP | 5.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|