C25H30O2Si — CID 99772953
(2E,4E,7S)-7-[tert-butyl(diphenyl)silyl]oxynona-2,4-dien-8-yn-1-ol (PubChem CID 99772953) has the molecular formula C25H30O2Si and a molecular weight of 390.60 g/mol. Its IUPAC name is (2E,4E,7S)-7-[tert-butyl(diphenyl)silyl]oxynona-2,4-dien-8-yn-1-ol.
| Compound Name | (2E,4E,7S)-7-[tert-butyl(diphenyl)silyl]oxynona-2,4-dien-8-yn-1-ol |
|---|---|
| PubChem CID | 99772953 |
| Molecular Formula | C25H30O2Si |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | (2E,4E,7S)-7-[tert-butyl(diphenyl)silyl]oxynona-2,4-dien-8-yn-1-ol |
| SMILES | C#C[C@H](C/C=C/C=C/CO)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H30O2Si/c1-5-22(16-10-6-7-15-21-26)27-28(25(2,3)4,23-17-11-8-12-18-23)24-19-13-9-14-20-24/h1,6-15,17-20,22,26H,16,21H2,2-4H3/b10-6+,15-7+/t22-/m1/s1 |
| InChIKey | XGHNQRVQFCNNEM-OUVYXGRJSA-N |
| XLogP | 4.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|