C27H30OSi — CID 135013582
tert-butyl-diphenyl-(5-phenylpent-1-yn-3-yloxy)silane (PubChem CID 135013582) has the molecular formula C27H30OSi and a molecular weight of 398.62 g/mol. Its IUPAC name is tert-butyl-diphenyl-(5-phenylpent-1-yn-3-yloxy)silane.
| Compound Name | tert-butyl-diphenyl-(5-phenylpent-1-yn-3-yloxy)silane |
|---|---|
| PubChem CID | 135013582 |
| Molecular Formula | C27H30OSi |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | tert-butyl-diphenyl-(5-phenylpent-1-yn-3-yloxy)silane |
| SMILES | C#CC(CCc1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H30OSi/c1-5-24(22-21-23-15-9-6-10-16-23)28-29(27(2,3)4,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h1,6-20,24H,21-22H2,2-4H3 |
| InChIKey | OQTXFXBIGFBRCO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|