C21H25FOSi — CID 122215628
tert-butyl-(3-fluoropent-4-ynoxy)-diphenylsilane (PubChem CID 122215628) has the molecular formula C21H25FOSi and a molecular weight of 340.51 g/mol. Its IUPAC name is tert-butyl-(3-fluoropent-4-ynoxy)-diphenylsilane.
| Compound Name | tert-butyl-(3-fluoropent-4-ynoxy)-diphenylsilane |
|---|---|
| PubChem CID | 122215628 |
| Molecular Formula | C21H25FOSi |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | tert-butyl-(3-fluoropent-4-ynoxy)-diphenylsilane |
| SMILES | C#CC(F)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H25FOSi/c1-5-18(22)16-17-23-24(21(2,3)4,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h1,6-15,18H,16-17H2,2-4H3 |
| InChIKey | MTOYGSXLJJVMJW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|