C24H30O2Si — CID 160529353
tert-butyl-but-3-ynoxy-diphenylsilane;but-3-yn-1-ol (PubChem CID 160529353) has the molecular formula C24H30O2Si and a molecular weight of 378.59 g/mol. Its IUPAC name is tert-butyl-but-3-ynoxy-diphenylsilane;but-3-yn-1-ol.
| Compound Name | tert-butyl-but-3-ynoxy-diphenylsilane;but-3-yn-1-ol |
|---|---|
| PubChem CID | 160529353 |
| Molecular Formula | C24H30O2Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | tert-butyl-but-3-ynoxy-diphenylsilane;but-3-yn-1-ol |
| SMILES | C#CCCO.C#CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C20H24OSi.C4H6O/c1-5-6-17-21-22(20(2,3)4,18-13-9-7-10-14-18)19-15-11-8-12-16-19;1-2-3-4-5/h1,7-16H,6,17H2,2-4H3;1,5H,3-4H2 |
| InChIKey | QVIDOUQXBFKWTC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|