C24H30OSi — CID 10546631
tert-butyl-[(E)-4-methylhept-3-en-6-ynoxy]-diphenylsilane (PubChem CID 10546631) has the molecular formula C24H30OSi and a molecular weight of 362.59 g/mol. Its IUPAC name is tert-butyl-[(E)-4-methylhept-3-en-6-ynoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-4-methylhept-3-en-6-ynoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10546631 |
| Molecular Formula | C24H30OSi |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | tert-butyl-[(E)-4-methylhept-3-en-6-ynoxy]-diphenylsilane |
| SMILES | C#CC/C(C)=C/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H30OSi/c1-6-14-21(2)15-13-20-25-26(24(3,4)5,22-16-9-7-10-17-22)23-18-11-8-12-19-23/h1,7-12,15-19H,13-14,20H2,2-5H3/b21-15+ |
| InChIKey | DEYZDEULNBIZLW-RCCKNPSSSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|