C27H40OSi — CID 135032541
tert-butyl-[(E)-2-methyldec-2-enoxy]-diphenylsilane (PubChem CID 135032541) has the molecular formula C27H40OSi and a molecular weight of 408.70 g/mol. Its IUPAC name is tert-butyl-[(E)-2-methyldec-2-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-2-methyldec-2-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 135032541 |
| Molecular Formula | C27H40OSi |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | tert-butyl-[(E)-2-methyldec-2-enoxy]-diphenylsilane |
| SMILES | CCCCCCC/C=C(\C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40OSi/c1-6-7-8-9-10-13-18-24(2)23-28-29(27(3,4)5,25-19-14-11-15-20-25)26-21-16-12-17-22-26/h11-12,14-22H,6-10,13,23H2,1-5H3/b24-18+ |
| InChIKey | DQYFXNVFIQIBBN-HKOYGPOVSA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|