C23H32OSi — CID 71217058
tert-butyl-[(Z)-2-methylhex-2-enoxy]-diphenylsilane (PubChem CID 71217058) has the molecular formula C23H32OSi and a molecular weight of 352.59 g/mol. Its IUPAC name is tert-butyl-[(Z)-2-methylhex-2-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(Z)-2-methylhex-2-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 71217058 |
| Molecular Formula | C23H32OSi |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl-[(Z)-2-methylhex-2-enoxy]-diphenylsilane |
| SMILES | CCC/C=C(/C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H32OSi/c1-6-7-14-20(2)19-24-25(23(3,4)5,21-15-10-8-11-16-21)22-17-12-9-13-18-22/h8-18H,6-7,19H2,1-5H3/b20-14- |
| InChIKey | RMYIUIFLVQEQKA-ZHZULCJRSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|