C21H29O5PSi — CID 175564241
[4-[tert-butyl(diphenyl)silyl]oxy-3-methylbut-2-enyl] dihydrogen phosphate (PubChem CID 175564241) has the molecular formula C21H29O5PSi and a molecular weight of 420.52 g/mol. Its IUPAC name is [4-[tert-butyl(diphenyl)silyl]oxy-3-methylbut-2-enyl] dihydrogen phosphate.
| Compound Name | [4-[tert-butyl(diphenyl)silyl]oxy-3-methylbut-2-enyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 175564241 |
| Molecular Formula | C21H29O5PSi |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [4-[tert-butyl(diphenyl)silyl]oxy-3-methylbut-2-enyl] dihydrogen phosphate |
| SMILES | CC(=CCOP(=O)(O)O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H29O5PSi/c1-18(15-16-25-27(22,23)24)17-26-28(21(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-15H,16-17H2,1-4H3,(H2,22,23,24) |
| InChIKey | NHXAQQNFRUOMEU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|