C25H34O2Si — CID 10763220
tert-butyl-[(2E,6Z)-7-methoxy-3-methylhepta-2,6-dienoxy]-diphenylsilane (PubChem CID 10763220) has the molecular formula C25H34O2Si and a molecular weight of 394.63 g/mol. Its IUPAC name is tert-butyl-[(2E,6Z)-7-methoxy-3-methylhepta-2,6-dienoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2E,6Z)-7-methoxy-3-methylhepta-2,6-dienoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10763220 |
| Molecular Formula | C25H34O2Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | tert-butyl-[(2E,6Z)-7-methoxy-3-methylhepta-2,6-dienoxy]-diphenylsilane |
| SMILES | CO/C=C\CC/C(C)=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H34O2Si/c1-22(14-12-13-20-26-5)19-21-27-28(25(2,3)4,23-15-8-6-9-16-23)24-17-10-7-11-18-24/h6-11,13,15-20H,12,14,21H2,1-5H3/b20-13-,22-19+ |
| InChIKey | ZXPPHHLMLDLADS-YGZBJQOJSA-N |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|