C26H36O2Si — CID 100941395
tert-butyl-[(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-diphenylsilane (PubChem CID 100941395) has the molecular formula C26H36O2Si and a molecular weight of 408.66 g/mol. Its IUPAC name is tert-butyl-[(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 100941395 |
| Molecular Formula | C26H36O2Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | tert-butyl-[(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-diphenylsilane |
| SMILES | C/C(=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC[C@H]1OC1(C)C |
| InChI | InChI=1S/C26H36O2Si/c1-21(17-18-24-26(5,6)28-24)19-20-27-29(25(2,3)4,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,19,24H,17-18,20H2,1-6H3/b21-19+/t24-/m1/s1 |
| InChIKey | LHGLXJUBCCJXJG-IVEWOJHHSA-N |
| XLogP | 5.47 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|