C27H38O2Si — CID 10740934
(2E,6E)-8-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-6-methylocta-2,6-dien-1-ol (PubChem CID 10740934) has the molecular formula C27H38O2Si and a molecular weight of 422.69 g/mol. Its IUPAC name is (2E,6E)-8-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-6-methylocta-2,6-dien-1-ol.
| Compound Name | (2E,6E)-8-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-6-methylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 10740934 |
| Molecular Formula | C27H38O2Si |
| Molecular Weight | 422.69 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | (2E,6E)-8-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-6-methylocta-2,6-dien-1-ol |
| SMILES | CC/C(=C\CC/C(C)=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CO |
| InChI | InChI=1S/C27H38O2Si/c1-6-24(22-28)15-13-14-23(2)20-21-29-30(27(3,4)5,25-16-9-7-10-17-25)26-18-11-8-12-19-26/h7-12,15-20,28H,6,13-14,21-22H2,1-5H3/b23-20+,24-15+ |
| InChIKey | SINGCIIASPEVDO-IKGRMMEISA-N |
| XLogP | 5.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.69 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|