C30H38O4SSi — CID 122395859
[(E)-6-[tert-butyl(diphenyl)silyl]oxy-1,1-dideuterio-4-methylhex-4-enyl] 4-methylbenzenesulfonate (PubChem CID 122395859) has the molecular formula C30H38O4SSi and a molecular weight of 524.80 g/mol. Its IUPAC name is [(E)-6-[tert-butyl(diphenyl)silyl]oxy-1,1-dideuterio-4-methylhex-4-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(E)-6-[tert-butyl(diphenyl)silyl]oxy-1,1-dideuterio-4-methylhex-4-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 122395859 |
| Molecular Formula | C30H38O4SSi |
| Molecular Weight | 524.80 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | [(E)-6-[tert-butyl(diphenyl)silyl]oxy-1,1-dideuterio-4-methylhex-4-enyl] 4-methylbenzenesulfonate |
| SMILES | [2H]C([2H])(CC/C(C)=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H38O4SSi/c1-25(13-12-23-33-35(31,32)27-20-18-26(2)19-21-27)22-24-34-36(30(3,4)5,28-14-8-6-9-15-28)29-16-10-7-11-17-29/h6-11,14-22H,12-13,23-24H2,1-5H3/b25-22+/i23D2 |
| InChIKey | SYSUXIUHMGJLLQ-JMZAMCQTSA-N |
| XLogP | 6.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.80 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|