C18H22O6S2 — CID 10787307
[1,1,4,4-tetradeuterio-4-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate (PubChem CID 10787307) has the molecular formula C18H22O6S2 and a molecular weight of 402.53 g/mol. Its IUPAC name is [1,1,4,4-tetradeuterio-4-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate.
| Compound Name | [1,1,4,4-tetradeuterio-4-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10787307 |
| Molecular Formula | C18H22O6S2 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | [1,1,4,4-tetradeuterio-4-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate |
| SMILES | [2H]C([2H])(CCC([2H])([2H])OS(=O)(=O)c1ccc(C)cc1)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H22O6S2/c1-15-5-9-17(10-6-15)25(19,20)23-13-3-4-14-24-26(21,22)18-11-7-16(2)8-12-18/h5-12H,3-4,13-14H2,1-2H3/i13D2,14D2 |
| InChIKey | FSQYJJHVABILHQ-RYIWKTDQSA-N |
| XLogP | 3.19 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|