C13H22O6S — CID 167570210
1,1,2,2-tetradeuterio-2-(trideuteriomethoxy)ethanol;[1,1,2,2-tetradeuterio-2-(trideuteriomethoxy)ethyl] 4-methylbenzenesulfonate (PubChem CID 167570210) has the molecular formula C13H22O6S and a molecular weight of 320.47 g/mol. Its IUPAC name is 1,1,2,2-tetradeuterio-2-(trideuteriomethoxy)ethanol;[1,1,2,2-tetradeuterio-2-(trideuteriomethoxy)ethyl] 4-methylbenzenesulfonate.
| Compound Name | 1,1,2,2-tetradeuterio-2-(trideuteriomethoxy)ethanol;[1,1,2,2-tetradeuterio-2-(trideuteriomethoxy)ethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 167570210 |
| Molecular Formula | C13H22O6S |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1,1,2,2-tetradeuterio-2-(trideuteriomethoxy)ethanol;[1,1,2,2-tetradeuterio-2-(trideuteriomethoxy)ethyl] 4-methylbenzenesulfonate |
| SMILES | [2H]C([2H])([2H])OC([2H])([2H])C([2H])([2H])O.[2H]C([2H])([2H])OC([2H])([2H])C([2H])([2H])OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C10H14O4S.C3H8O2/c1-9-3-5-10(6-4-9)15(11,12)14-8-7-13-2;1-5-3-2-4/h3-6H,7-8H2,1-2H3;4H,2-3H2,1H3/i2D3,7D2,8D2;1D3,2D2,3D2 |
| InChIKey | FUMUBDBSZQHTPR-GETDFIKHSA-N |
| XLogP | 0.97 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|