About ethyl 4-methylbenzenesulfonate;methyl 4-methylbenzenesulfonate
ethyl 4-methylbenzenesulfonate;methyl 4-methylbenzenesulfonate (PubChem CID 159715992) has the molecular formula C17H22O6S2
and a molecular weight of 386.49 g/mol. Its IUPAC name is ethyl 4-methylbenzenesulfonate;methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | ethyl 4-methylbenzenesulfonate;methyl 4-methylbenzenesulfonate |
| PubChem CID | 159715992 |
| Molecular Formula | C17H22O6S2 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | ethyl 4-methylbenzenesulfonate;methyl 4-methylbenzenesulfonate |
| SMILES | CCOS(=O)(=O)c1ccc(C)cc1.COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C9H12O3S.C8H10O3S/c1-3-12-13(10,11)9-6-4-8(2)5-7-9;1-7-3-5-8(6-4-7)12(9,10)11-2/h4-7H,3H2,1-2H3;3-6H,1-2H3 |
| InChIKey | MZKZGEQWKNQVNG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-methylbenzenesulfonate;methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-methylbenzenesulfonate;methyl 4-methylbenzenesulfonate?
The IUPAC name of ethyl 4-methylbenzenesulfonate;methyl 4-methylbenzenesulfonate (CID 159715992) is ethyl 4-methylbenzenesulfonate;methyl 4-methylbenzenesulfonate.
What is the SMILES notation for ethyl 4-methylbenzenesulfonate;methyl 4-methylbenzenesulfonate?
The canonical SMILES for ethyl 4-methylbenzenesulfonate;methyl 4-methylbenzenesulfonate is CCOS(=O)(=O)c1ccc(C)cc1.COS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of ethyl 4-methylbenzenesulfonate;methyl 4-methylbenzenesulfonate?
The InChIKey is MZKZGEQWKNQVNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3S.C8H10O3S/c1-3-12-13(10,11)9-6-4-8(2)5-7-9;1-7-3-5-8(6-4-7)12(9,10)11-2/h4-7H,3H2,1-2H3;3-6H,1-2H3.
What are the key properties of ethyl 4-methylbenzenesulfonate;methyl 4-methylbenzenesulfonate?
ethyl 4-methylbenzenesulfonate;methyl 4-methylbenzenesulfonate has a molecular weight of 386.49 g/mol, XLogP of 3.05, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-methylbenzenesulfonate;methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 159715992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).