About methyl 4-methylbenzenesulfonate;tris(2-methylpropyl)phosphane
methyl 4-methylbenzenesulfonate;tris(2-methylpropyl)phosphane (PubChem CID 174735726) has the molecular formula C20H37O3PS
and a molecular weight of 388.55 g/mol. Its IUPAC name is methyl 4-methylbenzenesulfonate;tris(2-methylpropyl)phosphane.
Molecular Properties
| Compound Name | methyl 4-methylbenzenesulfonate;tris(2-methylpropyl)phosphane |
| PubChem CID | 174735726 |
| Molecular Formula | C20H37O3PS |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | methyl 4-methylbenzenesulfonate;tris(2-methylpropyl)phosphane |
| SMILES | CC(C)CP(CC(C)C)CC(C)C.COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H27P.C8H10O3S/c1-10(2)7-13(8-11(3)4)9-12(5)6;1-7-3-5-8(6-4-7)12(9,10)11-2/h10-12H,7-9H2,1-6H3;3-6H,1-2H3 |
| InChIKey | ACUMQXLOGAQYBU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-methylbenzenesulfonate;tris(2-methylpropyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methylbenzenesulfonate;tris(2-methylpropyl)phosphane?
The IUPAC name of methyl 4-methylbenzenesulfonate;tris(2-methylpropyl)phosphane (CID 174735726) is methyl 4-methylbenzenesulfonate;tris(2-methylpropyl)phosphane.
What is the SMILES notation for methyl 4-methylbenzenesulfonate;tris(2-methylpropyl)phosphane?
The canonical SMILES for methyl 4-methylbenzenesulfonate;tris(2-methylpropyl)phosphane is CC(C)CP(CC(C)C)CC(C)C.COS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of methyl 4-methylbenzenesulfonate;tris(2-methylpropyl)phosphane?
The InChIKey is ACUMQXLOGAQYBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27P.C8H10O3S/c1-10(2)7-13(8-11(3)4)9-12(5)6;1-7-3-5-8(6-4-7)12(9,10)11-2/h10-12H,7-9H2,1-6H3;3-6H,1-2H3.
What are the key properties of methyl 4-methylbenzenesulfonate;tris(2-methylpropyl)phosphane?
methyl 4-methylbenzenesulfonate;tris(2-methylpropyl)phosphane has a molecular weight of 388.55 g/mol, XLogP of 5.77, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methylbenzenesulfonate;tris(2-methylpropyl)phosphane is sourced from PubChem (CID 174735726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).