About methyl 4-methylbenzenesulfonate;N-(4-methylphenyl)acetamide
methyl 4-methylbenzenesulfonate;N-(4-methylphenyl)acetamide (PubChem CID 158325152) has the molecular formula C17H21NO4S
and a molecular weight of 335.43 g/mol. Its IUPAC name is methyl 4-methylbenzenesulfonate;N-(4-methylphenyl)acetamide.
Molecular Properties
| Compound Name | methyl 4-methylbenzenesulfonate;N-(4-methylphenyl)acetamide |
| PubChem CID | 158325152 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | methyl 4-methylbenzenesulfonate;N-(4-methylphenyl)acetamide |
| SMILES | CC(=O)Nc1ccc(C)cc1.COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C9H11NO.C8H10O3S/c1-7-3-5-9(6-4-7)10-8(2)11;1-7-3-5-8(6-4-7)12(9,10)11-2/h3-6H,1-2H3,(H,10,11);3-6H,1-2H3 |
| InChIKey | GPHVWVAPIWYWPT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-methylbenzenesulfonate;N-(4-methylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methylbenzenesulfonate;N-(4-methylphenyl)acetamide?
The IUPAC name of methyl 4-methylbenzenesulfonate;N-(4-methylphenyl)acetamide (CID 158325152) is methyl 4-methylbenzenesulfonate;N-(4-methylphenyl)acetamide.
What is the SMILES notation for methyl 4-methylbenzenesulfonate;N-(4-methylphenyl)acetamide?
The canonical SMILES for methyl 4-methylbenzenesulfonate;N-(4-methylphenyl)acetamide is CC(=O)Nc1ccc(C)cc1.COS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of methyl 4-methylbenzenesulfonate;N-(4-methylphenyl)acetamide?
The InChIKey is GPHVWVAPIWYWPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.C8H10O3S/c1-7-3-5-9(6-4-7)10-8(2)11;1-7-3-5-8(6-4-7)12(9,10)11-2/h3-6H,1-2H3,(H,10,11);3-6H,1-2H3.
What are the key properties of methyl 4-methylbenzenesulfonate;N-(4-methylphenyl)acetamide?
methyl 4-methylbenzenesulfonate;N-(4-methylphenyl)acetamide has a molecular weight of 335.43 g/mol, XLogP of 3.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methylbenzenesulfonate;N-(4-methylphenyl)acetamide is sourced from PubChem (CID 158325152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).