About methyl 4-methylbenzenesulfonate;hydrofluoride
methyl 4-methylbenzenesulfonate;hydrofluoride (PubChem CID 158630886) has the molecular formula C8H11FO3S
and a molecular weight of 206.24 g/mol. Its IUPAC name is methyl 4-methylbenzenesulfonate;hydrofluoride.
Molecular Properties
| Compound Name | methyl 4-methylbenzenesulfonate;hydrofluoride |
| PubChem CID | 158630886 |
| Molecular Formula | C8H11FO3S |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | methyl 4-methylbenzenesulfonate;hydrofluoride |
| SMILES | COS(=O)(=O)c1ccc(C)cc1.F |
| InChI | InChI=1S/C8H10O3S.FH/c1-7-3-5-8(6-4-7)12(9,10)11-2;/h3-6H,1-2H3;1H |
| InChIKey | AYTXPGPEBKRMEM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-methylbenzenesulfonate;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methylbenzenesulfonate;hydrofluoride?
The IUPAC name of methyl 4-methylbenzenesulfonate;hydrofluoride (CID 158630886) is methyl 4-methylbenzenesulfonate;hydrofluoride.
What is the SMILES notation for methyl 4-methylbenzenesulfonate;hydrofluoride?
The canonical SMILES for methyl 4-methylbenzenesulfonate;hydrofluoride is COS(=O)(=O)c1ccc(C)cc1.F.
What is the InChIKey of methyl 4-methylbenzenesulfonate;hydrofluoride?
The InChIKey is AYTXPGPEBKRMEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3S.FH/c1-7-3-5-8(6-4-7)12(9,10)11-2;/h3-6H,1-2H3;1H.
What are the key properties of methyl 4-methylbenzenesulfonate;hydrofluoride?
methyl 4-methylbenzenesulfonate;hydrofluoride has a molecular weight of 206.24 g/mol, XLogP of 1.48, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methylbenzenesulfonate;hydrofluoride is sourced from PubChem (CID 158630886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).