About chloromethylbenzene;methyl 4-methylbenzenesulfonate
chloromethylbenzene;methyl 4-methylbenzenesulfonate (PubChem CID 174804366) has the molecular formula C15H17ClO3S
and a molecular weight of 312.82 g/mol. Its IUPAC name is chloromethylbenzene;methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | chloromethylbenzene;methyl 4-methylbenzenesulfonate |
| PubChem CID | 174804366 |
| Molecular Formula | C15H17ClO3S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | chloromethylbenzene;methyl 4-methylbenzenesulfonate |
| SMILES | COS(=O)(=O)c1ccc(C)cc1.ClCc1ccccc1 |
| InChI | InChI=1S/C8H10O3S.C7H7Cl/c1-7-3-5-8(6-4-7)12(9,10)11-2;8-6-7-4-2-1-3-5-7/h3-6H,1-2H3;1-5H,6H2 |
| InChIKey | ZNEUYDPZTORZRP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze chloromethylbenzene;methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethylbenzene;methyl 4-methylbenzenesulfonate?
The IUPAC name of chloromethylbenzene;methyl 4-methylbenzenesulfonate (CID 174804366) is chloromethylbenzene;methyl 4-methylbenzenesulfonate.
What is the SMILES notation for chloromethylbenzene;methyl 4-methylbenzenesulfonate?
The canonical SMILES for chloromethylbenzene;methyl 4-methylbenzenesulfonate is COS(=O)(=O)c1ccc(C)cc1.ClCc1ccccc1.
What is the InChIKey of chloromethylbenzene;methyl 4-methylbenzenesulfonate?
The InChIKey is ZNEUYDPZTORZRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3S.C7H7Cl/c1-7-3-5-8(6-4-7)12(9,10)11-2;8-6-7-4-2-1-3-5-7/h3-6H,1-2H3;1-5H,6H2.
What are the key properties of chloromethylbenzene;methyl 4-methylbenzenesulfonate?
chloromethylbenzene;methyl 4-methylbenzenesulfonate has a molecular weight of 312.82 g/mol, XLogP of 3.76, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethylbenzene;methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 174804366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).