C17H18Cl2O3S — CID 134875264
(1,1-dichloro-4-phenylbutan-2-yl) 4-methylbenzenesulfonate (PubChem CID 134875264) has the molecular formula C17H18Cl2O3S and a molecular weight of 373.30 g/mol. Its IUPAC name is (1,1-dichloro-4-phenylbutan-2-yl) 4-methylbenzenesulfonate.
| Compound Name | (1,1-dichloro-4-phenylbutan-2-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134875264 |
| Molecular Formula | C17H18Cl2O3S |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | (1,1-dichloro-4-phenylbutan-2-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(CCc2ccccc2)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C17H18Cl2O3S/c1-13-7-10-15(11-8-13)23(20,21)22-16(17(18)19)12-9-14-5-3-2-4-6-14/h2-8,10-11,16-17H,9,12H2,1H3 |
| InChIKey | AUZVIZSDWFUFDF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|