C27H34O6S — CID 159018865
[(2S)-2-hydroxy-4-phenylbutyl] 4-methylbenzenesulfonate;(2S)-4-phenylbutane-1,2-diol (PubChem CID 159018865) has the molecular formula C27H34O6S and a molecular weight of 486.63 g/mol. Its IUPAC name is [(2S)-2-hydroxy-4-phenylbutyl] 4-methylbenzenesulfonate;(2S)-4-phenylbutane-1,2-diol.
| Compound Name | [(2S)-2-hydroxy-4-phenylbutyl] 4-methylbenzenesulfonate;(2S)-4-phenylbutane-1,2-diol |
|---|---|
| PubChem CID | 159018865 |
| Molecular Formula | C27H34O6S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | [(2S)-2-hydroxy-4-phenylbutyl] 4-methylbenzenesulfonate;(2S)-4-phenylbutane-1,2-diol |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)CCc2ccccc2)cc1.OC[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C17H20O4S.C10H14O2/c1-14-7-11-17(12-8-14)22(19,20)21-13-16(18)10-9-15-5-3-2-4-6-15;11-8-10(12)7-6-9-4-2-1-3-5-9/h2-8,11-12,16,18H,9-10,13H2,1H3;1-5,10-12H,6-8H2/t16-;10-/m00/s1 |
| InChIKey | JTKZOMISAPQBIR-WEEWOMGQSA-N |
| XLogP | 3.67 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|