C30H30O5S — CID 86599063
[3-(3-benzyl-2-phenylmethoxyphenyl)-2-hydroxypropyl] 4-methylbenzenesulfonate (PubChem CID 86599063) has the molecular formula C30H30O5S and a molecular weight of 502.63 g/mol. Its IUPAC name is [3-(3-benzyl-2-phenylmethoxyphenyl)-2-hydroxypropyl] 4-methylbenzenesulfonate.
| Compound Name | [3-(3-benzyl-2-phenylmethoxyphenyl)-2-hydroxypropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86599063 |
| Molecular Formula | C30H30O5S |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | [3-(3-benzyl-2-phenylmethoxyphenyl)-2-hydroxypropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(O)Cc2cccc(Cc3ccccc3)c2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H30O5S/c1-23-15-17-29(18-16-23)36(32,33)35-22-28(31)20-27-14-8-13-26(19-24-9-4-2-5-10-24)30(27)34-21-25-11-6-3-7-12-25/h2-18,28,31H,19-22H2,1H3 |
| InChIKey | DLCWRAYJMXUVOO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|