C24H26O5S — CID 10982826
[(2S)-2,5-dihydroxy-5,5-diphenylpentyl] 4-methylbenzenesulfonate (PubChem CID 10982826) has the molecular formula C24H26O5S and a molecular weight of 426.53 g/mol. Its IUPAC name is [(2S)-2,5-dihydroxy-5,5-diphenylpentyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2,5-dihydroxy-5,5-diphenylpentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10982826 |
| Molecular Formula | C24H26O5S |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | [(2S)-2,5-dihydroxy-5,5-diphenylpentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)CCC(O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H26O5S/c1-19-12-14-23(15-13-19)30(27,28)29-18-22(25)16-17-24(26,20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-15,22,25-26H,16-18H2,1H3/t22-/m0/s1 |
| InChIKey | UBBZNQCQXQPUII-QFIPXVFZSA-N |
| XLogP | 3.78 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|